C18H23N3O3 — CID 174607016
(2S)-2-[(1-carbamoylcyclohexyl)amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 174607016) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is (2S)-2-[(1-carbamoylcyclohexyl)amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | (2S)-2-[(1-carbamoylcyclohexyl)amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 174607016 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | (2S)-2-[(1-carbamoylcyclohexyl)amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | NC(=O)C1(N[C@@H](Cc2c[nH]c3ccccc23)C(=O)O)CCCCC1 |
| InChI | InChI=1S/C18H23N3O3/c19-17(24)18(8-4-1-5-9-18)21-15(16(22)23)10-12-11-20-14-7-3-2-6-13(12)14/h2-3,6-7,11,15,20-21H,1,4-5,8-10H2,(H2,19,24)(H,22,23)/t15-/m0/s1 |
| InChIKey | QQHHDVWWJOHNNY-HNNXBMFYSA-N |
| XLogP | 1.94 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |