C10H13NO5S — CID 174607137
1-(hydroxymethyl)-3-methoxycarbonyl-5-[methyl(sulfino)amino]benzene (PubChem CID 174607137) has the molecular formula C10H13NO5S and a molecular weight of 259.28 g/mol. Its IUPAC name is 1-(hydroxymethyl)-3-methoxycarbonyl-5-[methyl(sulfino)amino]benzene.
| Compound Name | 1-(hydroxymethyl)-3-methoxycarbonyl-5-[methyl(sulfino)amino]benzene |
|---|---|
| PubChem CID | 174607137 |
| Molecular Formula | C10H13NO5S |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 1-(hydroxymethyl)-3-methoxycarbonyl-5-[methyl(sulfino)amino]benzene |
| SMILES | COC(=O)c1cc(CO)cc(N(C)S(=O)O)c1 |
| InChI | InChI=1S/C10H13NO5S/c1-11(17(14)15)9-4-7(6-12)3-8(5-9)10(13)16-2/h3-5,12H,6H2,1-2H3,(H,14,15) |
| InChIKey | VOQQETPNLYLAGU-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|