About 2-nitrosulfonyloxyoctane
2-nitrosulfonyloxyoctane (PubChem CID 174611671) has the molecular formula C8H17NO5S
and a molecular weight of 239.29 g/mol. Its IUPAC name is 2-nitrosulfonyloxyoctane.
Molecular Properties
| Compound Name | 2-nitrosulfonyloxyoctane |
| PubChem CID | 174611671 |
| Molecular Formula | C8H17NO5S |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 2-nitrosulfonyloxyoctane |
| SMILES | CCCCCCC(C)OS(=O)(=O)[N+](=O)[O-] |
| InChI | InChI=1S/C8H17NO5S/c1-3-4-5-6-7-8(2)14-15(12,13)9(10)11/h8H,3-7H2,1-2H3 |
| InChIKey | ARUBBDFCXBVURO-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitrosulfonyloxyoctane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitrosulfonyloxyoctane?
The IUPAC name of 2-nitrosulfonyloxyoctane (CID 174611671) is 2-nitrosulfonyloxyoctane.
What is the SMILES notation for 2-nitrosulfonyloxyoctane?
The canonical SMILES for 2-nitrosulfonyloxyoctane is CCCCCCC(C)OS(=O)(=O)[N+](=O)[O-].
What is the InChIKey of 2-nitrosulfonyloxyoctane?
The InChIKey is ARUBBDFCXBVURO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO5S/c1-3-4-5-6-7-8(2)14-15(12,13)9(10)11/h8H,3-7H2,1-2H3.
What are the key properties of 2-nitrosulfonyloxyoctane?
2-nitrosulfonyloxyoctane has a molecular weight of 239.29 g/mol, XLogP of 1.88, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitrosulfonyloxyoctane is sourced from PubChem (CID 174611671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).