About 6-bromo-4,4-dimethyl-2,3-dihydro-1H-chrysene
6-bromo-4,4-dimethyl-2,3-dihydro-1H-chrysene (PubChem CID 174612552) has the molecular formula C20H19Br
and a molecular weight of 339.28 g/mol. Its IUPAC name is 6-bromo-4,4-dimethyl-2,3-dihydro-1H-chrysene.
Molecular Properties
| Compound Name | 6-bromo-4,4-dimethyl-2,3-dihydro-1H-chrysene |
| PubChem CID | 174612552 |
| Molecular Formula | C20H19Br |
| Molecular Weight | 339.28 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 6-bromo-4,4-dimethyl-2,3-dihydro-1H-chrysene |
| SMILES | CC1(C)CCCc2ccc3c(cc(Br)c4ccccc43)c21 |
| InChI | InChI=1S/C20H19Br/c1-20(2)11-5-6-13-9-10-15-14-7-3-4-8-16(14)18(21)12-17(15)19(13)20/h3-4,7-10,12H,5-6,11H2,1-2H3 |
| InChIKey | UCXLCBGTWVVOTM-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 339.28 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-4,4-dimethyl-2,3-dihydro-1H-chrysene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-4,4-dimethyl-2,3-dihydro-1H-chrysene?
The IUPAC name of 6-bromo-4,4-dimethyl-2,3-dihydro-1H-chrysene (CID 174612552) is 6-bromo-4,4-dimethyl-2,3-dihydro-1H-chrysene.
What is the SMILES notation for 6-bromo-4,4-dimethyl-2,3-dihydro-1H-chrysene?
The canonical SMILES for 6-bromo-4,4-dimethyl-2,3-dihydro-1H-chrysene is CC1(C)CCCc2ccc3c(cc(Br)c4ccccc43)c21.
What is the InChIKey of 6-bromo-4,4-dimethyl-2,3-dihydro-1H-chrysene?
The InChIKey is UCXLCBGTWVVOTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19Br/c1-20(2)11-5-6-13-9-10-15-14-7-3-4-8-16(14)18(21)12-17(15)19(13)20/h3-4,7-10,12H,5-6,11H2,1-2H3.
What are the key properties of 6-bromo-4,4-dimethyl-2,3-dihydro-1H-chrysene?
6-bromo-4,4-dimethyl-2,3-dihydro-1H-chrysene has a molecular weight of 339.28 g/mol, XLogP of 6.37, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-4,4-dimethyl-2,3-dihydro-1H-chrysene is sourced from PubChem (CID 174612552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).