C20H19Br — CID 174612552
6-bromo-4,4-dimethyl-2,3-dihydro-1H-chrysene (PubChem CID 174612552) has the molecular formula C20H19Br and a molecular weight of 339.28 g/mol. Its IUPAC name is 6-bromo-4,4-dimethyl-2,3-dihydro-1H-chrysene.
| Compound Name | 6-bromo-4,4-dimethyl-2,3-dihydro-1H-chrysene |
|---|---|
| PubChem CID | 174612552 |
| Molecular Formula | C20H19Br |
| Molecular Weight | 339.28 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 6-bromo-4,4-dimethyl-2,3-dihydro-1H-chrysene |
| SMILES | CC1(C)CCCc2ccc3c(cc(Br)c4ccccc43)c21 |
| InChI | InChI=1S/C20H19Br/c1-20(2)11-5-6-13-9-10-15-14-7-3-4-8-16(14)18(21)12-17(15)19(13)20/h3-4,7-10,12H,5-6,11H2,1-2H3 |
| InChIKey | UCXLCBGTWVVOTM-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.28 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|