C6H13ClF3NO2 — CID 174612782
2-amino-3-(trifluoromethyl)pentane-1,3-diol;hydrochloride (PubChem CID 174612782) has the molecular formula C6H13ClF3NO2 and a molecular weight of 223.62 g/mol. Its IUPAC name is 2-amino-3-(trifluoromethyl)pentane-1,3-diol;hydrochloride.
| Compound Name | 2-amino-3-(trifluoromethyl)pentane-1,3-diol;hydrochloride |
|---|---|
| PubChem CID | 174612782 |
| Molecular Formula | C6H13ClF3NO2 |
| Molecular Weight | 223.62 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 2-amino-3-(trifluoromethyl)pentane-1,3-diol;hydrochloride |
| SMILES | CCC(O)(C(N)CO)C(F)(F)F.Cl |
| InChI | InChI=1S/C6H12F3NO2.ClH/c1-2-5(12,4(10)3-11)6(7,8)9;/h4,11-12H,2-3,10H2,1H3;1H |
| InChIKey | USGIZYMHKYHGNK-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.62 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |