C15H22F2N2O2S — CID 17461365
3,5-difluoro-N-[3-(4-methylpiperidin-1-yl)propyl]benzenesulfonamide (PubChem CID 17461365) has the molecular formula C15H22F2N2O2S and a molecular weight of 332.42 g/mol. Its IUPAC name is 3,5-difluoro-N-[3-(4-methylpiperidin-1-yl)propyl]benzenesulfonamide.
| Compound Name | 3,5-difluoro-N-[3-(4-methylpiperidin-1-yl)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 17461365 |
| Molecular Formula | C15H22F2N2O2S |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 3,5-difluoro-N-[3-(4-methylpiperidin-1-yl)propyl]benzenesulfonamide |
| SMILES | CC1CCN(CCCNS(=O)(=O)c2cc(F)cc(F)c2)CC1 |
| InChI | InChI=1S/C15H22F2N2O2S/c1-12-3-7-19(8-4-12)6-2-5-18-22(20,21)15-10-13(16)9-14(17)11-15/h9-12,18H,2-8H2,1H3 |
| InChIKey | AQUJTVPEGFQEGW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|