(4-methylpiperidin-1-yl) 3-(2,2,2-trifluoroethyl)benzoate

C15H18F3NO2 — CID 174613871

IUPAC(4-methylpiperidin-1-yl) 3-(2,2,2-trifluoroethyl)benzoate
SMILESCC1CCN(OC(=O)c2cccc(CC(F)(F)F)c2)CC1
InChIInChI=1S/C15H18F3NO2/c1-11-5-7-19(8-6-11)21-14(20)13-4-2-3-12(9-13)10-15(16,17)18/h2-4,9,11H,5-8,10H2,1H3
InChIKeyZPHNALYMSYFJIL-UHFFFAOYSA-N
MW301.31 g/mol
LogP3.60
Rot. Bonds3

About (4-methylpiperidin-1-yl) 3-(2,2,2-trifluoroethyl)benzoate

(4-methylpiperidin-1-yl) 3-(2,2,2-trifluoroethyl)benzoate (PubChem CID 174613871) has the molecular formula C15H18F3NO2 and a molecular weight of 301.31 g/mol. Its IUPAC name is (4-methylpiperidin-1-yl) 3-(2,2,2-trifluoroethyl)benzoate.

Molecular Properties

Compound Name(4-methylpiperidin-1-yl) 3-(2,2,2-trifluoroethyl)benzoate
PubChem CID174613871
Molecular FormulaC15H18F3NO2
Molecular Weight301.31 g/mol
Exact Mass301.13
IUPAC Name(4-methylpiperidin-1-yl) 3-(2,2,2-trifluoroethyl)benzoate
SMILESCC1CCN(OC(=O)c2cccc(CC(F)(F)F)c2)CC1
InChIInChI=1S/C15H18F3NO2/c1-11-5-7-19(8-6-11)21-14(20)13-4-2-3-12(9-13)10-15(16,17)18/h2-4,9,11H,5-8,10H2,1H3
InChIKeyZPHNALYMSYFJIL-UHFFFAOYSA-N
XLogP3.60
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500301.31
LogP ≤ 53.60
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze (4-methylpiperidin-1-yl) 3-(2,2,2-trifluoroethyl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-methylpiperidin-1-yl) 3-(2,2,2-trifluoroethyl)benzoate?
The IUPAC name of (4-methylpiperidin-1-yl) 3-(2,2,2-trifluoroethyl)benzoate (CID 174613871) is (4-methylpiperidin-1-yl) 3-(2,2,2-trifluoroethyl)benzoate.
What is the SMILES notation for (4-methylpiperidin-1-yl) 3-(2,2,2-trifluoroethyl)benzoate?
The canonical SMILES for (4-methylpiperidin-1-yl) 3-(2,2,2-trifluoroethyl)benzoate is CC1CCN(OC(=O)c2cccc(CC(F)(F)F)c2)CC1.
What is the InChIKey of (4-methylpiperidin-1-yl) 3-(2,2,2-trifluoroethyl)benzoate?
The InChIKey is ZPHNALYMSYFJIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18F3NO2/c1-11-5-7-19(8-6-11)21-14(20)13-4-2-3-12(9-13)10-15(16,17)18/h2-4,9,11H,5-8,10H2,1H3.
What are the key properties of (4-methylpiperidin-1-yl) 3-(2,2,2-trifluoroethyl)benzoate?
(4-methylpiperidin-1-yl) 3-(2,2,2-trifluoroethyl)benzoate has a molecular weight of 301.31 g/mol, XLogP of 3.60, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylpiperidin-1-yl) 3-(2,2,2-trifluoroethyl)benzoate is sourced from PubChem (CID 174613871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).