C15H18F3NO2 — CID 174613871
(4-methylpiperidin-1-yl) 3-(2,2,2-trifluoroethyl)benzoate (PubChem CID 174613871) has the molecular formula C15H18F3NO2 and a molecular weight of 301.31 g/mol. Its IUPAC name is (4-methylpiperidin-1-yl) 3-(2,2,2-trifluoroethyl)benzoate.
| Compound Name | (4-methylpiperidin-1-yl) 3-(2,2,2-trifluoroethyl)benzoate |
|---|---|
| PubChem CID | 174613871 |
| Molecular Formula | C15H18F3NO2 |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | (4-methylpiperidin-1-yl) 3-(2,2,2-trifluoroethyl)benzoate |
| SMILES | CC1CCN(OC(=O)c2cccc(CC(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C15H18F3NO2/c1-11-5-7-19(8-6-11)21-14(20)13-4-2-3-12(9-13)10-15(16,17)18/h2-4,9,11H,5-8,10H2,1H3 |
| InChIKey | ZPHNALYMSYFJIL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |