About azane;trimethyl(1-phenylethyl)azanium;chloride
azane;trimethyl(1-phenylethyl)azanium;chloride (PubChem CID 174615232) has the molecular formula C11H21ClN2
and a molecular weight of 216.76 g/mol. Its IUPAC name is azane;trimethyl(1-phenylethyl)azanium;chloride.
Molecular Properties
| Compound Name | azane;trimethyl(1-phenylethyl)azanium;chloride |
| PubChem CID | 174615232 |
| Molecular Formula | C11H21ClN2 |
| Molecular Weight | 216.76 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | azane;trimethyl(1-phenylethyl)azanium;chloride |
| SMILES | CC(c1ccccc1)[N+](C)(C)C.N.[Cl-] |
| InChI | InChI=1S/C11H18N.ClH.H3N/c1-10(12(2,3)4)11-8-6-5-7-9-11;;/h5-10H,1-4H3;1H;1H3/q+1;;/p-1 |
| InChIKey | AMOLLAIGTBVBHB-UHFFFAOYSA-M |
| XLogP | -0.38 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.76 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze azane;trimethyl(1-phenylethyl)azanium;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;trimethyl(1-phenylethyl)azanium;chloride?
The IUPAC name of azane;trimethyl(1-phenylethyl)azanium;chloride (CID 174615232) is azane;trimethyl(1-phenylethyl)azanium;chloride.
What is the SMILES notation for azane;trimethyl(1-phenylethyl)azanium;chloride?
The canonical SMILES for azane;trimethyl(1-phenylethyl)azanium;chloride is CC(c1ccccc1)[N+](C)(C)C.N.[Cl-].
What is the InChIKey of azane;trimethyl(1-phenylethyl)azanium;chloride?
The InChIKey is AMOLLAIGTBVBHB-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H18N.ClH.H3N/c1-10(12(2,3)4)11-8-6-5-7-9-11;;/h5-10H,1-4H3;1H;1H3/q+1;;/p-1.
What are the key properties of azane;trimethyl(1-phenylethyl)azanium;chloride?
azane;trimethyl(1-phenylethyl)azanium;chloride has a molecular weight of 216.76 g/mol, XLogP of -0.38, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azane;trimethyl(1-phenylethyl)azanium;chloride is sourced from PubChem (CID 174615232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).