C20H31N3O2 — CID 174615690
1-[4-(4-benzylpiperazin-1-yl)piperidin-1-yl]ethyl acetate (PubChem CID 174615690) has the molecular formula C20H31N3O2 and a molecular weight of 345.49 g/mol. Its IUPAC name is 1-[4-(4-benzylpiperazin-1-yl)piperidin-1-yl]ethyl acetate.
| Compound Name | 1-[4-(4-benzylpiperazin-1-yl)piperidin-1-yl]ethyl acetate |
|---|---|
| PubChem CID | 174615690 |
| Molecular Formula | C20H31N3O2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | 1-[4-(4-benzylpiperazin-1-yl)piperidin-1-yl]ethyl acetate |
| SMILES | CC(=O)OC(C)N1CCC(N2CCN(Cc3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C20H31N3O2/c1-17(25-18(2)24)22-10-8-20(9-11-22)23-14-12-21(13-15-23)16-19-6-4-3-5-7-19/h3-7,17,20H,8-16H2,1-2H3 |
| InChIKey | ULVPJPVVMZRJSE-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |