C18H14FN — CID 174616067
N-fluoro-N,3-diphenylaniline (PubChem CID 174616067) has the molecular formula C18H14FN and a molecular weight of 263.31 g/mol. Its IUPAC name is N-fluoro-N,3-diphenylaniline.
| Compound Name | N-fluoro-N,3-diphenylaniline |
|---|---|
| PubChem CID | 174616067 |
| Molecular Formula | C18H14FN |
| Molecular Weight | 263.31 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | N-fluoro-N,3-diphenylaniline |
| SMILES | FN(c1ccccc1)c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C18H14FN/c19-20(17-11-5-2-6-12-17)18-13-7-10-16(14-18)15-8-3-1-4-9-15/h1-14H |
| InChIKey | QZPHVYVSIPVQQD-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.31 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|