About tert-butylsulfanylmethylsulfanyl-diethoxy-sulfanylidene-λ5-phosphane;octane;zinc
tert-butylsulfanylmethylsulfanyl-diethoxy-sulfanylidene-λ5-phosphane;octane;zinc (PubChem CID 174617217) has the molecular formula C17H38O2PS3Zn-
and a molecular weight of 467.05 g/mol. Its IUPAC name is tert-butylsulfanylmethylsulfanyl-diethoxy-sulfanylidene-λ5-phosphane;octane;zinc.
Molecular Properties
| Compound Name | tert-butylsulfanylmethylsulfanyl-diethoxy-sulfanylidene-λ5-phosphane;octane;zinc |
| PubChem CID | 174617217 |
| Molecular Formula | C17H38O2PS3Zn- |
| Molecular Weight | 467.05 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | tert-butylsulfanylmethylsulfanyl-diethoxy-sulfanylidene-λ5-phosphane;octane;zinc |
| SMILES | CCOP(=S)(OCC)SCSC(C)(C)C.[CH2-]CCCCCCC.[Zn] |
| InChI | InChI=1S/C9H21O2PS3.C8H17.Zn/c1-6-10-12(13,11-7-2)15-8-14-9(3,4)5;1-3-5-7-8-6-4-2;/h6-8H2,1-5H3;1,3-8H2,2H3;/q;-1; |
| InChIKey | MIJSQORBGDLAJY-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 467.05 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tert-butylsulfanylmethylsulfanyl-diethoxy-sulfanylidene-λ5-phosphane;octane;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butylsulfanylmethylsulfanyl-diethoxy-sulfanylidene-λ5-phosphane;octane;zinc?
The IUPAC name of tert-butylsulfanylmethylsulfanyl-diethoxy-sulfanylidene-λ5-phosphane;octane;zinc (CID 174617217) is tert-butylsulfanylmethylsulfanyl-diethoxy-sulfanylidene-λ5-phosphane;octane;zinc.
What is the SMILES notation for tert-butylsulfanylmethylsulfanyl-diethoxy-sulfanylidene-λ5-phosphane;octane;zinc?
The canonical SMILES for tert-butylsulfanylmethylsulfanyl-diethoxy-sulfanylidene-λ5-phosphane;octane;zinc is CCOP(=S)(OCC)SCSC(C)(C)C.[CH2-]CCCCCCC.[Zn].
What is the InChIKey of tert-butylsulfanylmethylsulfanyl-diethoxy-sulfanylidene-λ5-phosphane;octane;zinc?
The InChIKey is MIJSQORBGDLAJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21O2PS3.C8H17.Zn/c1-6-10-12(13,11-7-2)15-8-14-9(3,4)5;1-3-5-7-8-6-4-2;/h6-8H2,1-5H3;1,3-8H2,2H3;/q;-1;.
What are the key properties of tert-butylsulfanylmethylsulfanyl-diethoxy-sulfanylidene-λ5-phosphane;octane;zinc?
tert-butylsulfanylmethylsulfanyl-diethoxy-sulfanylidene-λ5-phosphane;octane;zinc has a molecular weight of 467.05 g/mol, XLogP of 7.68, 12 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butylsulfanylmethylsulfanyl-diethoxy-sulfanylidene-λ5-phosphane;octane;zinc is sourced from PubChem (CID 174617217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).