C18H42O4P2S6 — CID 23447087
tert-butylsulfanylmethylsulfanyl-diethoxy-sulfanylidene-λ5-phosphane (PubChem CID 23447087) has the molecular formula C18H42O4P2S6 and a molecular weight of 576.88 g/mol. Its IUPAC name is tert-butylsulfanylmethylsulfanyl-diethoxy-sulfanylidene-λ5-phosphane.
| Compound Name | tert-butylsulfanylmethylsulfanyl-diethoxy-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 23447087 |
| Molecular Formula | C18H42O4P2S6 |
| Molecular Weight | 576.88 g/mol |
| Exact Mass | 576.09 |
| IUPAC Name | tert-butylsulfanylmethylsulfanyl-diethoxy-sulfanylidene-λ5-phosphane |
| SMILES | CCOP(=S)(OCC)SCSC(C)(C)C.CCOP(=S)(OCC)SCSC(C)(C)C |
| InChI | InChI=1S/2C9H21O2PS3/c2*1-6-10-12(13,11-7-2)15-8-14-9(3,4)5/h2*6-8H2,1-5H3 |
| InChIKey | CHBBMQUQMBEFMK-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.88 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|