C15H36O5P2S6 — CID 87622218
diethoxy-(ethylsulfanylmethylsulfanyl)-sulfanylidene-λ5-phosphane;diethoxy-(2-ethylsulfinylethylsulfanyl)-sulfanylidene-λ5-phosphane (PubChem CID 87622218) has the molecular formula C15H36O5P2S6 and a molecular weight of 550.80 g/mol. Its IUPAC name is diethoxy-(ethylsulfanylmethylsulfanyl)-sulfanylidene-λ5-phosphane;diethoxy-(2-ethylsulfinylethylsulfanyl)-sulfanylidene-λ5-phosphane.
| Compound Name | diethoxy-(ethylsulfanylmethylsulfanyl)-sulfanylidene-λ5-phosphane;diethoxy-(2-ethylsulfinylethylsulfanyl)-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 87622218 |
| Molecular Formula | C15H36O5P2S6 |
| Molecular Weight | 550.80 g/mol |
| Exact Mass | 550.04 |
| IUPAC Name | diethoxy-(ethylsulfanylmethylsulfanyl)-sulfanylidene-λ5-phosphane;diethoxy-(2-ethylsulfinylethylsulfanyl)-sulfanylidene-λ5-phosphane |
| SMILES | CCOP(=S)(OCC)SCCS(=O)CC.CCOP(=S)(OCC)SCSCC |
| InChI | InChI=1S/C8H19O3PS3.C7H17O2PS3/c1-4-10-12(13,11-5-2)14-7-8-15(9)6-3;1-4-8-10(11,9-5-2)13-7-12-6-3/h4-8H2,1-3H3;4-7H2,1-3H3 |
| InChIKey | XGQITUNMCZXGIM-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.80 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|