C16H38O4P2S5 — CID 165360439
diethoxy-(2-ethylsulfanylethylsulfanyl)-sulfanylidene-λ5-phosphane;1-[ethoxy(propylsulfanyl)phosphoryl]sulfanylpropane (PubChem CID 165360439) has the molecular formula C16H38O4P2S5 and a molecular weight of 516.76 g/mol. Its IUPAC name is diethoxy-(2-ethylsulfanylethylsulfanyl)-sulfanylidene-λ5-phosphane;1-[ethoxy(propylsulfanyl)phosphoryl]sulfanylpropane.
| Compound Name | diethoxy-(2-ethylsulfanylethylsulfanyl)-sulfanylidene-λ5-phosphane;1-[ethoxy(propylsulfanyl)phosphoryl]sulfanylpropane |
|---|---|
| PubChem CID | 165360439 |
| Molecular Formula | C16H38O4P2S5 |
| Molecular Weight | 516.76 g/mol |
| Exact Mass | 516.08 |
| IUPAC Name | diethoxy-(2-ethylsulfanylethylsulfanyl)-sulfanylidene-λ5-phosphane;1-[ethoxy(propylsulfanyl)phosphoryl]sulfanylpropane |
| SMILES | CCCSP(=O)(OCC)SCCC.CCOP(=S)(OCC)SCCSCC |
| InChI | InChI=1S/C8H19O2PS3.C8H19O2PS2/c1-4-9-11(12,10-5-2)14-8-7-13-6-3;1-4-7-12-11(9,10-6-3)13-8-5-2/h4-8H2,1-3H3;4-8H2,1-3H3 |
| InChIKey | IBQLLYQMLSZSTL-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.76 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|