C8H19O4PS3 — CID 17241
diethoxy-(2-ethylsulfonylethylsulfanyl)-sulfanylidene-lambda5-phosphane (PubChem CID 17241) has the molecular formula C8H19O4PS3 and a molecular weight of 306.41 g/mol. Its IUPAC name is diethoxy-(2-ethylsulfonylethylsulfanyl)-sulfanylidene-lambda5-phosphane.
| Compound Name | diethoxy-(2-ethylsulfonylethylsulfanyl)-sulfanylidene-lambda5-phosphane |
|---|---|
| PubChem CID | 17241 |
| Molecular Formula | C8H19O4PS3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | diethoxy-(2-ethylsulfonylethylsulfanyl)-sulfanylidene-lambda5-phosphane |
| SMILES | CCOP(=S)(OCC)SCCS(=O)(=O)CC |
| InChI | InChI=1S/C8H19O4PS3/c1-4-11-13(14,12-5-2)15-7-8-16(9,10)6-3/h4-8H2,1-3H3 |
| InChIKey | BKVJOVPVLOJPKJ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|