C9H21NO4PS3- — CID 18924387
diethoxy-(2-ethylsulfanylethylsulfanyl)-sulfanylidene-λ5-phosphane carbamate (PubChem CID 18924387) has the molecular formula C9H21NO4PS3- and a molecular weight of 334.45 g/mol. Its IUPAC name is diethoxy-(2-ethylsulfanylethylsulfanyl)-sulfanylidene-λ5-phosphane carbamate.
| Compound Name | diethoxy-(2-ethylsulfanylethylsulfanyl)-sulfanylidene-λ5-phosphane carbamate |
|---|---|
| PubChem CID | 18924387 |
| Molecular Formula | C9H21NO4PS3- |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | diethoxy-(2-ethylsulfanylethylsulfanyl)-sulfanylidene-λ5-phosphane carbamate |
| SMILES | CCOP(=S)(OCC)SCCSCC.NC(=O)[O-] |
| InChI | InChI=1S/C8H19O2PS3.CH3NO2/c1-4-9-11(12,10-5-2)14-8-7-13-6-3;2-1(3)4/h4-8H2,1-3H3;2H2,(H,3,4)/p-1 |
| InChIKey | DPBOPEDLQOMOKT-UHFFFAOYSA-M |
| XLogP | 2.06 |
| TPSA | 84.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|