About diethoxy-(2-ethylsulfanylethylsulfanyl)-sulfanylidene-λ5-phosphane carbamate
diethoxy-(2-ethylsulfanylethylsulfanyl)-sulfanylidene-λ5-phosphane carbamate (PubChem CID 18924387) has the molecular formula C9H21NO4PS3-
and a molecular weight of 334.45 g/mol. Its IUPAC name is diethoxy-(2-ethylsulfanylethylsulfanyl)-sulfanylidene-λ5-phosphane carbamate.
Molecular Properties
| Compound Name | diethoxy-(2-ethylsulfanylethylsulfanyl)-sulfanylidene-λ5-phosphane carbamate |
| PubChem CID | 18924387 |
| Molecular Formula | C9H21NO4PS3- |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | diethoxy-(2-ethylsulfanylethylsulfanyl)-sulfanylidene-λ5-phosphane carbamate |
| SMILES | CCOP(=S)(OCC)SCCSCC.NC(=O)[O-] |
| InChI | InChI=1S/C8H19O2PS3.CH3NO2/c1-4-9-11(12,10-5-2)14-8-7-13-6-3;2-1(3)4/h4-8H2,1-3H3;2H2,(H,3,4)/p-1 |
| InChIKey | DPBOPEDLQOMOKT-UHFFFAOYSA-M |
| XLogP | 2.06 |
| TPSA | 84.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diethoxy-(2-ethylsulfanylethylsulfanyl)-sulfanylidene-λ5-phosphane carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethoxy-(2-ethylsulfanylethylsulfanyl)-sulfanylidene-λ5-phosphane carbamate?
The IUPAC name of diethoxy-(2-ethylsulfanylethylsulfanyl)-sulfanylidene-λ5-phosphane carbamate (CID 18924387) is diethoxy-(2-ethylsulfanylethylsulfanyl)-sulfanylidene-λ5-phosphane carbamate.
What is the SMILES notation for diethoxy-(2-ethylsulfanylethylsulfanyl)-sulfanylidene-λ5-phosphane carbamate?
The canonical SMILES for diethoxy-(2-ethylsulfanylethylsulfanyl)-sulfanylidene-λ5-phosphane carbamate is CCOP(=S)(OCC)SCCSCC.NC(=O)[O-].
What is the InChIKey of diethoxy-(2-ethylsulfanylethylsulfanyl)-sulfanylidene-λ5-phosphane carbamate?
The InChIKey is DPBOPEDLQOMOKT-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H19O2PS3.CH3NO2/c1-4-9-11(12,10-5-2)14-8-7-13-6-3;2-1(3)4/h4-8H2,1-3H3;2H2,(H,3,4)/p-1.
What are the key properties of diethoxy-(2-ethylsulfanylethylsulfanyl)-sulfanylidene-λ5-phosphane carbamate?
diethoxy-(2-ethylsulfanylethylsulfanyl)-sulfanylidene-λ5-phosphane carbamate has a molecular weight of 334.45 g/mol, XLogP of 2.06, 9 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for diethoxy-(2-ethylsulfanylethylsulfanyl)-sulfanylidene-λ5-phosphane carbamate is sourced from PubChem (CID 18924387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).