C19H22ClN3O4 — CID 17461797
2-[5-chloro-2-(3-methylphenoxy)anilino]-N-(2-methoxyethylcarbamoyl)acetamide (PubChem CID 17461797) has the molecular formula C19H22ClN3O4 and a molecular weight of 391.86 g/mol. Its IUPAC name is 2-[5-chloro-2-(3-methylphenoxy)anilino]-N-(2-methoxyethylcarbamoyl)acetamide.
| Compound Name | 2-[5-chloro-2-(3-methylphenoxy)anilino]-N-(2-methoxyethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 17461797 |
| Molecular Formula | C19H22ClN3O4 |
| Molecular Weight | 391.86 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 2-[5-chloro-2-(3-methylphenoxy)anilino]-N-(2-methoxyethylcarbamoyl)acetamide |
| SMILES | COCCNC(=O)NC(=O)CNc1cc(Cl)ccc1Oc1cccc(C)c1 |
| InChI | InChI=1S/C19H22ClN3O4/c1-13-4-3-5-15(10-13)27-17-7-6-14(20)11-16(17)22-12-18(24)23-19(25)21-8-9-26-2/h3-7,10-11,22H,8-9,12H2,1-2H3,(H2,21,23,24,25) |
| InChIKey | RCGKUFRZPWNKDX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.86 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|