C13H17F2N3O4 — CID 37480115
2-[2-(difluoromethoxy)anilino]-N-(2-methoxyethylcarbamoyl)acetamide (PubChem CID 37480115) has the molecular formula C13H17F2N3O4 and a molecular weight of 317.29 g/mol. Its IUPAC name is 2-[2-(difluoromethoxy)anilino]-N-(2-methoxyethylcarbamoyl)acetamide.
| Compound Name | 2-[2-(difluoromethoxy)anilino]-N-(2-methoxyethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 37480115 |
| Molecular Formula | C13H17F2N3O4 |
| Molecular Weight | 317.29 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 2-[2-(difluoromethoxy)anilino]-N-(2-methoxyethylcarbamoyl)acetamide |
| SMILES | COCCNC(=O)NC(=O)CNc1ccccc1OC(F)F |
| InChI | InChI=1S/C13H17F2N3O4/c1-21-7-6-16-13(20)18-11(19)8-17-9-4-2-3-5-10(9)22-12(14)15/h2-5,12,17H,6-8H2,1H3,(H2,16,18,19,20) |
| InChIKey | AMVDQFWYPVJERE-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.29 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|