C14H17F4N3O4 — CID 18271470
2-[5-fluoro-2-(2,2,2-trifluoroethoxy)anilino]-N-(2-methoxyethylcarbamoyl)acetamide (PubChem CID 18271470) has the molecular formula C14H17F4N3O4 and a molecular weight of 367.30 g/mol. Its IUPAC name is 2-[5-fluoro-2-(2,2,2-trifluoroethoxy)anilino]-N-(2-methoxyethylcarbamoyl)acetamide.
| Compound Name | 2-[5-fluoro-2-(2,2,2-trifluoroethoxy)anilino]-N-(2-methoxyethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 18271470 |
| Molecular Formula | C14H17F4N3O4 |
| Molecular Weight | 367.30 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 2-[5-fluoro-2-(2,2,2-trifluoroethoxy)anilino]-N-(2-methoxyethylcarbamoyl)acetamide |
| SMILES | COCCNC(=O)NC(=O)CNc1cc(F)ccc1OCC(F)(F)F |
| InChI | InChI=1S/C14H17F4N3O4/c1-24-5-4-19-13(23)21-12(22)7-20-10-6-9(15)2-3-11(10)25-8-14(16,17)18/h2-3,6,20H,4-5,7-8H2,1H3,(H2,19,21,22,23) |
| InChIKey | NNZAVPYYELMXII-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.30 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|