C12H27NOSi2 — CID 174618234
2-cyclohexyl-2,2-bis(dimethylsilyl)acetamide (PubChem CID 174618234) has the molecular formula C12H27NOSi2 and a molecular weight of 257.53 g/mol. Its IUPAC name is 2-cyclohexyl-2,2-bis(dimethylsilyl)acetamide.
| Compound Name | 2-cyclohexyl-2,2-bis(dimethylsilyl)acetamide |
|---|---|
| PubChem CID | 174618234 |
| Molecular Formula | C12H27NOSi2 |
| Molecular Weight | 257.53 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 2-cyclohexyl-2,2-bis(dimethylsilyl)acetamide |
| SMILES | C[SiH](C)C(C(N)=O)(C1CCCCC1)[SiH](C)C |
| InChI | InChI=1S/C12H27NOSi2/c1-15(2)12(11(13)14,16(3)4)10-8-6-5-7-9-10/h10,15-16H,5-9H2,1-4H3,(H2,13,14) |
| InChIKey | HDVUQFNHPWBHHH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.53 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|