C20H18O2 — CID 174619845
2-[[4-[2-(4-methylphenyl)ethynyl]phenyl]methyl]cyclopropane-1-carboxylic acid (PubChem CID 174619845) has the molecular formula C20H18O2 and a molecular weight of 290.36 g/mol. Its IUPAC name is 2-[[4-[2-(4-methylphenyl)ethynyl]phenyl]methyl]cyclopropane-1-carboxylic acid.
| Compound Name | 2-[[4-[2-(4-methylphenyl)ethynyl]phenyl]methyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 174619845 |
| Molecular Formula | C20H18O2 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 2-[[4-[2-(4-methylphenyl)ethynyl]phenyl]methyl]cyclopropane-1-carboxylic acid |
| SMILES | Cc1ccc(C#Cc2ccc(CC3CC3C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C20H18O2/c1-14-2-4-15(5-3-14)6-7-16-8-10-17(11-9-16)12-18-13-19(18)20(21)22/h2-5,8-11,18-19H,12-13H2,1H3,(H,21,22) |
| InChIKey | CLWKHWUQQYXGDX-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|