H11NO16P4 — CID 174621290
azane;dihydroxy hydrogen phosphate;diphosphono hydrogen phosphate (PubChem CID 174621290) has the molecular formula H11NO16P4 and a molecular weight of 404.98 g/mol. Its IUPAC name is azane;dihydroxy hydrogen phosphate;diphosphono hydrogen phosphate.
| Compound Name | azane;dihydroxy hydrogen phosphate;diphosphono hydrogen phosphate |
|---|---|
| PubChem CID | 174621290 |
| Molecular Formula | H11NO16P4 |
| Molecular Weight | 404.98 g/mol |
| Exact Mass | 404.90 |
| IUPAC Name | azane;dihydroxy hydrogen phosphate;diphosphono hydrogen phosphate |
| SMILES | N.O=P(O)(O)OP(=O)(O)OP(=O)(O)O.O=P(O)(OO)OO |
| InChI | InChI=1S/H3N.H5O10P3.H3O6P/c;1-11(2,3)9-13(7,8)10-12(4,5)6;1-5-7(3,4)6-2/h1H3;(H,7,8)(H2,1,2,3)(H2,4,5,6);1-2H,(H,3,4) |
| InChIKey | HGIRVMFWJFZKTQ-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 302.04 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.98 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|