C15H29N4O2S+ — CID 174621491
[(2S)-1-(benzenesulfonyl)-2,3,3-tris(methylamino)propyl]-trimethylazanium (PubChem CID 174621491) has the molecular formula C15H29N4O2S+ and a molecular weight of 329.49 g/mol. Its IUPAC name is [(2S)-1-(benzenesulfonyl)-2,3,3-tris(methylamino)propyl]-trimethylazanium.
| Compound Name | [(2S)-1-(benzenesulfonyl)-2,3,3-tris(methylamino)propyl]-trimethylazanium |
|---|---|
| PubChem CID | 174621491 |
| Molecular Formula | C15H29N4O2S+ |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | [(2S)-1-(benzenesulfonyl)-2,3,3-tris(methylamino)propyl]-trimethylazanium |
| SMILES | CNC(NC)[C@H](NC)C([N+](C)(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H29N4O2S/c1-16-13(14(17-2)18-3)15(19(4,5)6)22(20,21)12-10-8-7-9-11-12/h7-11,13-18H,1-6H3/q+1/t13-,15?/m0/s1 |
| InChIKey | YRHMPSMKLLLZOL-CFMCSPIPSA-N |
| XLogP | -0.15 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|