C18H20ClNO5 — CID 17462179
N-(5-chloro-2-methoxyphenyl)-2-(2,3,4-trimethoxyphenyl)acetamide (PubChem CID 17462179) has the molecular formula C18H20ClNO5 and a molecular weight of 365.81 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-2-(2,3,4-trimethoxyphenyl)acetamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-2-(2,3,4-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 17462179 |
| Molecular Formula | C18H20ClNO5 |
| Molecular Weight | 365.81 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-2-(2,3,4-trimethoxyphenyl)acetamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)Cc1ccc(OC)c(OC)c1OC |
| InChI | InChI=1S/C18H20ClNO5/c1-22-14-8-6-12(19)10-13(14)20-16(21)9-11-5-7-15(23-2)18(25-4)17(11)24-3/h5-8,10H,9H2,1-4H3,(H,20,21) |
| InChIKey | GXGLELXMAAPBAC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.81 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |