About 1,4-diamino-5-fluoropyrimidin-2-one;hydron
1,4-diamino-5-fluoropyrimidin-2-one;hydron (PubChem CID 174621899) has the molecular formula C4H6FN4O+
and a molecular weight of 145.12 g/mol. Its IUPAC name is 1,4-diamino-5-fluoropyrimidin-2-one;hydron.
Molecular Properties
| Compound Name | 1,4-diamino-5-fluoropyrimidin-2-one;hydron |
| PubChem CID | 174621899 |
| Molecular Formula | C4H6FN4O+ |
| Molecular Weight | 145.12 g/mol |
| Exact Mass | 145.05 |
| IUPAC Name | 1,4-diamino-5-fluoropyrimidin-2-one;hydron |
| SMILES | Nc1nc(=O)n(N)cc1F.[H+] |
| InChI | InChI=1S/C4H5FN4O/c5-2-1-9(7)4(10)8-3(2)6/h1H,7H2,(H2,6,8,10)/p+1 |
| InChIKey | YZEJIIKKLLEIGG-UHFFFAOYSA-O |
| XLogP | -1.21 |
| TPSA | 86.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.12 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,4-diamino-5-fluoropyrimidin-2-one;hydron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-diamino-5-fluoropyrimidin-2-one;hydron?
The IUPAC name of 1,4-diamino-5-fluoropyrimidin-2-one;hydron (CID 174621899) is 1,4-diamino-5-fluoropyrimidin-2-one;hydron.
What is the SMILES notation for 1,4-diamino-5-fluoropyrimidin-2-one;hydron?
The canonical SMILES for 1,4-diamino-5-fluoropyrimidin-2-one;hydron is Nc1nc(=O)n(N)cc1F.[H+].
What is the InChIKey of 1,4-diamino-5-fluoropyrimidin-2-one;hydron?
The InChIKey is YZEJIIKKLLEIGG-UHFFFAOYSA-O. The full InChI is InChI=1S/C4H5FN4O/c5-2-1-9(7)4(10)8-3(2)6/h1H,7H2,(H2,6,8,10)/p+1.
What are the key properties of 1,4-diamino-5-fluoropyrimidin-2-one;hydron?
1,4-diamino-5-fluoropyrimidin-2-one;hydron has a molecular weight of 145.12 g/mol, XLogP of -1.21, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-diamino-5-fluoropyrimidin-2-one;hydron is sourced from PubChem (CID 174621899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).