C16H24N2O2 — CID 174623381
(6-piperidin-4-yl-3-pyridinyl)methyl 2,2-dimethylpropanoate (PubChem CID 174623381) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is (6-piperidin-4-yl-3-pyridinyl)methyl 2,2-dimethylpropanoate.
| Compound Name | (6-piperidin-4-yl-3-pyridinyl)methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 174623381 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | (6-piperidin-4-yl-3-pyridinyl)methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCc1ccc(C2CCNCC2)nc1 |
| InChI | InChI=1S/C16H24N2O2/c1-16(2,3)15(19)20-11-12-4-5-14(18-10-12)13-6-8-17-9-7-13/h4-5,10,13,17H,6-9,11H2,1-3H3 |
| InChIKey | BNSRAMISUCAEMO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |