C18H27NO4 — CID 174624397
cyclohexanol;(2,2-dimethyl-3H-1-benzofuran-7-yl) N-methylcarbamate (PubChem CID 174624397) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is cyclohexanol;(2,2-dimethyl-3H-1-benzofuran-7-yl) N-methylcarbamate.
| Compound Name | cyclohexanol;(2,2-dimethyl-3H-1-benzofuran-7-yl) N-methylcarbamate |
|---|---|
| PubChem CID | 174624397 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | cyclohexanol;(2,2-dimethyl-3H-1-benzofuran-7-yl) N-methylcarbamate |
| SMILES | CNC(=O)Oc1cccc2c1OC(C)(C)C2.OC1CCCCC1 |
| InChI | InChI=1S/C12H15NO3.C6H12O/c1-12(2)7-8-5-4-6-9(10(8)16-12)15-11(14)13-3;7-6-4-2-1-3-5-6/h4-6H,7H2,1-3H3,(H,13,14);6-7H,1-5H2 |
| InChIKey | FIULWAMTRJCNAP-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |