C20H15N4O5S2- — CID 174625036
4-[5-[1-(3-methylsulfonylphenyl)-4-oxopyridazin-3-yl]pyrazol-1-yl]benzenesulfinate (PubChem CID 174625036) has the molecular formula C20H15N4O5S2- and a molecular weight of 455.50 g/mol. Its IUPAC name is 4-[5-[1-(3-methylsulfonylphenyl)-4-oxopyridazin-3-yl]pyrazol-1-yl]benzenesulfinate.
| Compound Name | 4-[5-[1-(3-methylsulfonylphenyl)-4-oxopyridazin-3-yl]pyrazol-1-yl]benzenesulfinate |
|---|---|
| PubChem CID | 174625036 |
| Molecular Formula | C20H15N4O5S2- |
| Molecular Weight | 455.50 g/mol |
| Exact Mass | 455.05 |
| IUPAC Name | 4-[5-[1-(3-methylsulfonylphenyl)-4-oxopyridazin-3-yl]pyrazol-1-yl]benzenesulfinate |
| SMILES | CS(=O)(=O)c1cccc(-n2ccc(=O)c(-c3ccnn3-c3ccc(S(=O)[O-])cc3)n2)c1 |
| InChI | InChI=1S/C20H16N4O5S2/c1-31(28,29)17-4-2-3-15(13-17)23-12-10-19(25)20(22-23)18-9-11-21-24(18)14-5-7-16(8-6-14)30(26)27/h2-13H,1H3,(H,26,27)/p-1 |
| InChIKey | WLVVSISGVHTARO-UHFFFAOYSA-M |
| XLogP | 1.73 |
| TPSA | 126.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.50 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|