C20H15N4O3S- — CID 174729751
[2-[4-oxo-3-(2-phenylpyrazol-3-yl)pyridazin-1-yl]phenyl]methanesulfinate (PubChem CID 174729751) has the molecular formula C20H15N4O3S- and a molecular weight of 391.43 g/mol. Its IUPAC name is [2-[4-oxo-3-(2-phenylpyrazol-3-yl)pyridazin-1-yl]phenyl]methanesulfinate.
| Compound Name | [2-[4-oxo-3-(2-phenylpyrazol-3-yl)pyridazin-1-yl]phenyl]methanesulfinate |
|---|---|
| PubChem CID | 174729751 |
| Molecular Formula | C20H15N4O3S- |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | [2-[4-oxo-3-(2-phenylpyrazol-3-yl)pyridazin-1-yl]phenyl]methanesulfinate |
| SMILES | O=c1ccn(-c2ccccc2CS(=O)[O-])nc1-c1ccnn1-c1ccccc1 |
| InChI | InChI=1S/C20H16N4O3S/c25-19-11-13-23(17-9-5-4-6-15(17)14-28(26)27)22-20(19)18-10-12-21-24(18)16-7-2-1-3-8-16/h1-13H,14H2,(H,26,27)/p-1 |
| InChIKey | UUSZTYNCNDOSAY-UHFFFAOYSA-M |
| XLogP | 2.46 |
| TPSA | 92.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|