C20H14N4O3 — CID 46219190
3-[2-(1,3-benzodioxol-5-yl)pyrazol-3-yl]-1-phenylpyridazin-4-one (PubChem CID 46219190) has the molecular formula C20H14N4O3 and a molecular weight of 358.36 g/mol. Its IUPAC name is 3-[2-(1,3-benzodioxol-5-yl)pyrazol-3-yl]-1-phenylpyridazin-4-one.
| Compound Name | 3-[2-(1,3-benzodioxol-5-yl)pyrazol-3-yl]-1-phenylpyridazin-4-one |
|---|---|
| PubChem CID | 46219190 |
| Molecular Formula | C20H14N4O3 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 3-[2-(1,3-benzodioxol-5-yl)pyrazol-3-yl]-1-phenylpyridazin-4-one |
| SMILES | O=c1ccn(-c2ccccc2)nc1-c1ccnn1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H14N4O3/c25-17-9-11-23(14-4-2-1-3-5-14)22-20(17)16-8-10-21-24(16)15-6-7-18-19(12-15)27-13-26-18/h1-12H,13H2 |
| InChIKey | DTFDCZOEQXRKSB-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 71.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |