About dichlorozirconium;(2,4-diphenylcyclopenta-1,4-dien-1-yl)benzene
dichlorozirconium;(2,4-diphenylcyclopenta-1,4-dien-1-yl)benzene (PubChem CID 174625406) has the molecular formula C23H18Cl2Zr
and a molecular weight of 456.53 g/mol. Its IUPAC name is dichlorozirconium;(2,4-diphenylcyclopenta-1,4-dien-1-yl)benzene.
Molecular Properties
| Compound Name | dichlorozirconium;(2,4-diphenylcyclopenta-1,4-dien-1-yl)benzene |
| PubChem CID | 174625406 |
| Molecular Formula | C23H18Cl2Zr |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 453.98 |
| IUPAC Name | dichlorozirconium;(2,4-diphenylcyclopenta-1,4-dien-1-yl)benzene |
| SMILES | C1=C(c2ccccc2)CC(c2ccccc2)=C1c1ccccc1.Cl[Zr]Cl |
| InChI | InChI=1S/C23H18.2ClH.Zr/c1-4-10-18(11-5-1)21-16-22(19-12-6-2-7-13-19)23(17-21)20-14-8-3-9-15-20;;;/h1-16H,17H2;2*1H;/q;;;+2/p-2 |
| InChIKey | FXAVRRPULPZBBN-UHFFFAOYSA-L |
| XLogP | 7.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze dichlorozirconium;(2,4-diphenylcyclopenta-1,4-dien-1-yl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorozirconium;(2,4-diphenylcyclopenta-1,4-dien-1-yl)benzene?
The IUPAC name of dichlorozirconium;(2,4-diphenylcyclopenta-1,4-dien-1-yl)benzene (CID 174625406) is dichlorozirconium;(2,4-diphenylcyclopenta-1,4-dien-1-yl)benzene.
What is the SMILES notation for dichlorozirconium;(2,4-diphenylcyclopenta-1,4-dien-1-yl)benzene?
The canonical SMILES for dichlorozirconium;(2,4-diphenylcyclopenta-1,4-dien-1-yl)benzene is C1=C(c2ccccc2)CC(c2ccccc2)=C1c1ccccc1.Cl[Zr]Cl.
What is the InChIKey of dichlorozirconium;(2,4-diphenylcyclopenta-1,4-dien-1-yl)benzene?
The InChIKey is FXAVRRPULPZBBN-UHFFFAOYSA-L. The full InChI is InChI=1S/C23H18.2ClH.Zr/c1-4-10-18(11-5-1)21-16-22(19-12-6-2-7-13-19)23(17-21)20-14-8-3-9-15-20;;;/h1-16H,17H2;2*1H;/q;;;+2/p-2.
What are the key properties of dichlorozirconium;(2,4-diphenylcyclopenta-1,4-dien-1-yl)benzene?
dichlorozirconium;(2,4-diphenylcyclopenta-1,4-dien-1-yl)benzene has a molecular weight of 456.53 g/mol, XLogP of 7.46, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorozirconium;(2,4-diphenylcyclopenta-1,4-dien-1-yl)benzene is sourced from PubChem (CID 174625406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).