C25H22O2 — CID 102201867
1-methoxy-4-[2-(4-methoxyphenyl)-4-phenylcyclopenta-1,3-dien-1-yl]benzene (PubChem CID 102201867) has the molecular formula C25H22O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is 1-methoxy-4-[2-(4-methoxyphenyl)-4-phenylcyclopenta-1,3-dien-1-yl]benzene.
| Compound Name | 1-methoxy-4-[2-(4-methoxyphenyl)-4-phenylcyclopenta-1,3-dien-1-yl]benzene |
|---|---|
| PubChem CID | 102201867 |
| Molecular Formula | C25H22O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 1-methoxy-4-[2-(4-methoxyphenyl)-4-phenylcyclopenta-1,3-dien-1-yl]benzene |
| SMILES | COc1ccc(C2=C(c3ccc(OC)cc3)CC(c3ccccc3)=C2)cc1 |
| InChI | InChI=1S/C25H22O2/c1-26-22-12-8-19(9-13-22)24-16-21(18-6-4-3-5-7-18)17-25(24)20-10-14-23(27-2)15-11-20/h3-16H,17H2,1-2H3 |
| InChIKey | UJRFLYUGMVFSQF-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|