C21H25N3O2 — CID 174627831
2-[[1-(4-cyclopropylphenyl)piperidin-4-yl]methyl]-5-hydroxy-6-methylpyrimidine-4-carbaldehyde (PubChem CID 174627831) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 2-[[1-(4-cyclopropylphenyl)piperidin-4-yl]methyl]-5-hydroxy-6-methylpyrimidine-4-carbaldehyde.
| Compound Name | 2-[[1-(4-cyclopropylphenyl)piperidin-4-yl]methyl]-5-hydroxy-6-methylpyrimidine-4-carbaldehyde |
|---|---|
| PubChem CID | 174627831 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 2-[[1-(4-cyclopropylphenyl)piperidin-4-yl]methyl]-5-hydroxy-6-methylpyrimidine-4-carbaldehyde |
| SMILES | Cc1nc(CC2CCN(c3ccc(C4CC4)cc3)CC2)nc(C=O)c1O |
| InChI | InChI=1S/C21H25N3O2/c1-14-21(26)19(13-25)23-20(22-14)12-15-8-10-24(11-9-15)18-6-4-17(5-7-18)16-2-3-16/h4-7,13,15-16,26H,2-3,8-12H2,1H3 |
| InChIKey | NXVBIGXQZYXGMV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|