C22H31N3O2 — CID 70965890
4-(methoxymethyl)-6-methyl-2-[[1-(4-propylphenyl)piperidin-4-yl]methyl]pyrimidin-5-ol (PubChem CID 70965890) has the molecular formula C22H31N3O2 and a molecular weight of 369.51 g/mol. Its IUPAC name is 4-(methoxymethyl)-6-methyl-2-[[1-(4-propylphenyl)piperidin-4-yl]methyl]pyrimidin-5-ol.
| Compound Name | 4-(methoxymethyl)-6-methyl-2-[[1-(4-propylphenyl)piperidin-4-yl]methyl]pyrimidin-5-ol |
|---|---|
| PubChem CID | 70965890 |
| Molecular Formula | C22H31N3O2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | 4-(methoxymethyl)-6-methyl-2-[[1-(4-propylphenyl)piperidin-4-yl]methyl]pyrimidin-5-ol |
| SMILES | CCCc1ccc(N2CCC(Cc3nc(C)c(O)c(COC)n3)CC2)cc1 |
| InChI | InChI=1S/C22H31N3O2/c1-4-5-17-6-8-19(9-7-17)25-12-10-18(11-13-25)14-21-23-16(2)22(26)20(24-21)15-27-3/h6-9,18,26H,4-5,10-15H2,1-3H3 |
| InChIKey | BUDSYWNOTKCZQF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|