C13H9F3N2O4S — CID 174629530
[3-[(2,5-difluorophenyl)sulfonylamino]-2-fluorophenyl] carbamate (PubChem CID 174629530) has the molecular formula C13H9F3N2O4S and a molecular weight of 346.29 g/mol. Its IUPAC name is [3-[(2,5-difluorophenyl)sulfonylamino]-2-fluorophenyl] carbamate.
| Compound Name | [3-[(2,5-difluorophenyl)sulfonylamino]-2-fluorophenyl] carbamate |
|---|---|
| PubChem CID | 174629530 |
| Molecular Formula | C13H9F3N2O4S |
| Molecular Weight | 346.29 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | [3-[(2,5-difluorophenyl)sulfonylamino]-2-fluorophenyl] carbamate |
| SMILES | NC(=O)Oc1cccc(NS(=O)(=O)c2cc(F)ccc2F)c1F |
| InChI | InChI=1S/C13H9F3N2O4S/c14-7-4-5-8(15)11(6-7)23(20,21)18-9-2-1-3-10(12(9)16)22-13(17)19/h1-6,18H,(H2,17,19) |
| InChIKey | XMWABAMLQGQVQS-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.29 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |