C31H32F3N3O2 — CID 174630033
N-[(2R)-4-imino-5-[3-(trifluoromethyl)phenyl]pentan-2-yl]-2-(2-oxo-3,3-diphenylpiperidin-1-yl)acetamide (PubChem CID 174630033) has the molecular formula C31H32F3N3O2 and a molecular weight of 535.61 g/mol. Its IUPAC name is N-[(2R)-4-imino-5-[3-(trifluoromethyl)phenyl]pentan-2-yl]-2-(2-oxo-3,3-diphenylpiperidin-1-yl)acetamide.
| Compound Name | N-[(2R)-4-imino-5-[3-(trifluoromethyl)phenyl]pentan-2-yl]-2-(2-oxo-3,3-diphenylpiperidin-1-yl)acetamide |
|---|---|
| PubChem CID | 174630033 |
| Molecular Formula | C31H32F3N3O2 |
| Molecular Weight | 535.61 g/mol |
| Exact Mass | 535.24 |
| IUPAC Name | N-[(2R)-4-imino-5-[3-(trifluoromethyl)phenyl]pentan-2-yl]-2-(2-oxo-3,3-diphenylpiperidin-1-yl)acetamide |
| SMILES | [H]/N=C(\Cc1cccc(C(F)(F)F)c1)C[C@@H](C)NC(=O)CN1CCCC(c2ccccc2)(c2ccccc2)C1=O |
| InChI | InChI=1S/C31H32F3N3O2/c1-22(18-27(35)20-23-10-8-15-26(19-23)31(32,33)34)36-28(38)21-37-17-9-16-30(29(37)39,24-11-4-2-5-12-24)25-13-6-3-7-14-25/h2-8,10-15,19,22,35H,9,16-18,20-21H2,1H3,(H,36,38)/b35-27-/t22-/m1/s1 |
| InChIKey | SXHNUJIWWYXWDH-KPSNJVHISA-N |
| XLogP | 5.77 |
| TPSA | 73.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.61 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|