About anisole;2-ethynylchromen-4-one
anisole;2-ethynylchromen-4-one (PubChem CID 174631759) has the molecular formula C18H14O3
and a molecular weight of 278.31 g/mol. Its IUPAC name is anisole;2-ethynylchromen-4-one.
Molecular Properties
| Compound Name | anisole;2-ethynylchromen-4-one |
| PubChem CID | 174631759 |
| Molecular Formula | C18H14O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | anisole;2-ethynylchromen-4-one |
| SMILES | C#Cc1cc(=O)c2ccccc2o1.COc1ccccc1 |
| InChI | InChI=1S/C11H6O2.C7H8O/c1-2-8-7-10(12)9-5-3-4-6-11(9)13-8;1-8-7-5-3-2-4-6-7/h1,3-7H;2-6H,1H3 |
| InChIKey | KWELBHDQNNWONG-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze anisole;2-ethynylchromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anisole;2-ethynylchromen-4-one?
The IUPAC name of anisole;2-ethynylchromen-4-one (CID 174631759) is anisole;2-ethynylchromen-4-one.
What is the SMILES notation for anisole;2-ethynylchromen-4-one?
The canonical SMILES for anisole;2-ethynylchromen-4-one is C#Cc1cc(=O)c2ccccc2o1.COc1ccccc1.
What is the InChIKey of anisole;2-ethynylchromen-4-one?
The InChIKey is KWELBHDQNNWONG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6O2.C7H8O/c1-2-8-7-10(12)9-5-3-4-6-11(9)13-8;1-8-7-5-3-2-4-6-7/h1,3-7H;2-6H,1H3.
What are the key properties of anisole;2-ethynylchromen-4-one?
anisole;2-ethynylchromen-4-one has a molecular weight of 278.31 g/mol, XLogP of 3.47, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for anisole;2-ethynylchromen-4-one is sourced from PubChem (CID 174631759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).