C6H15N3 — CID 174631925
1-N,1-N',3-N-trimethylprop-2-ene-1,1,3-triamine (PubChem CID 174631925) has the molecular formula C6H15N3 and a molecular weight of 129.21 g/mol. Its IUPAC name is 1-N,1-N',3-N-trimethylprop-2-ene-1,1,3-triamine.
| Compound Name | 1-N,1-N',3-N-trimethylprop-2-ene-1,1,3-triamine |
|---|---|
| PubChem CID | 174631925 |
| Molecular Formula | C6H15N3 |
| Molecular Weight | 129.21 g/mol |
| Exact Mass | 129.13 |
| IUPAC Name | 1-N,1-N',3-N-trimethylprop-2-ene-1,1,3-triamine |
| SMILES | CNC=CC(NC)NC |
| InChI | InChI=1S/C6H15N3/c1-7-5-4-6(8-2)9-3/h4-9H,1-3H3 |
| InChIKey | XOCPGOUKPCISBH-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.21 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|