About anisole;ethyl(trimethoxy)silane
anisole;ethyl(trimethoxy)silane (PubChem CID 174632605) has the molecular formula C12H22O4Si
and a molecular weight of 258.39 g/mol. Its IUPAC name is anisole;ethyl(trimethoxy)silane.
Molecular Properties
| Compound Name | anisole;ethyl(trimethoxy)silane |
| PubChem CID | 174632605 |
| Molecular Formula | C12H22O4Si |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | anisole;ethyl(trimethoxy)silane |
| SMILES | CC[Si](OC)(OC)OC.COc1ccccc1 |
| InChI | InChI=1S/C7H8O.C5H14O3Si/c1-8-7-5-3-2-4-6-7;1-5-9(6-2,7-3)8-4/h2-6H,1H3;5H2,1-4H3 |
| InChIKey | OYRGASCZTFAFRK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze anisole;ethyl(trimethoxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anisole;ethyl(trimethoxy)silane?
The IUPAC name of anisole;ethyl(trimethoxy)silane (CID 174632605) is anisole;ethyl(trimethoxy)silane.
What is the SMILES notation for anisole;ethyl(trimethoxy)silane?
The canonical SMILES for anisole;ethyl(trimethoxy)silane is CC[Si](OC)(OC)OC.COc1ccccc1.
What is the InChIKey of anisole;ethyl(trimethoxy)silane?
The InChIKey is OYRGASCZTFAFRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.C5H14O3Si/c1-8-7-5-3-2-4-6-7;1-5-9(6-2,7-3)8-4/h2-6H,1H3;5H2,1-4H3.
What are the key properties of anisole;ethyl(trimethoxy)silane?
anisole;ethyl(trimethoxy)silane has a molecular weight of 258.39 g/mol, XLogP of 2.58, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for anisole;ethyl(trimethoxy)silane is sourced from PubChem (CID 174632605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).