About ethyl(trimethoxy)silane;trimethoxy-(2-methylphenyl)silane
ethyl(trimethoxy)silane;trimethoxy-(2-methylphenyl)silane (PubChem CID 174740549) has the molecular formula C15H30O6Si2
and a molecular weight of 362.57 g/mol. Its IUPAC name is ethyl(trimethoxy)silane;trimethoxy-(2-methylphenyl)silane.
Molecular Properties
| Compound Name | ethyl(trimethoxy)silane;trimethoxy-(2-methylphenyl)silane |
| PubChem CID | 174740549 |
| Molecular Formula | C15H30O6Si2 |
| Molecular Weight | 362.57 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | ethyl(trimethoxy)silane;trimethoxy-(2-methylphenyl)silane |
| SMILES | CC[Si](OC)(OC)OC.CO[Si](OC)(OC)c1ccccc1C |
| InChI | InChI=1S/C10H16O3Si.C5H14O3Si/c1-9-7-5-6-8-10(9)14(11-2,12-3)13-4;1-5-9(6-2,7-3)8-4/h5-8H,1-4H3;5H2,1-4H3 |
| InChIKey | KBAURDJHDLHGHX-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.57 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethyl(trimethoxy)silane;trimethoxy-(2-methylphenyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl(trimethoxy)silane;trimethoxy-(2-methylphenyl)silane?
The IUPAC name of ethyl(trimethoxy)silane;trimethoxy-(2-methylphenyl)silane (CID 174740549) is ethyl(trimethoxy)silane;trimethoxy-(2-methylphenyl)silane.
What is the SMILES notation for ethyl(trimethoxy)silane;trimethoxy-(2-methylphenyl)silane?
The canonical SMILES for ethyl(trimethoxy)silane;trimethoxy-(2-methylphenyl)silane is CC[Si](OC)(OC)OC.CO[Si](OC)(OC)c1ccccc1C.
What is the InChIKey of ethyl(trimethoxy)silane;trimethoxy-(2-methylphenyl)silane?
The InChIKey is KBAURDJHDLHGHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O3Si.C5H14O3Si/c1-9-7-5-6-8-10(9)14(11-2,12-3)13-4;1-5-9(6-2,7-3)8-4/h5-8H,1-4H3;5H2,1-4H3.
What are the key properties of ethyl(trimethoxy)silane;trimethoxy-(2-methylphenyl)silane?
ethyl(trimethoxy)silane;trimethoxy-(2-methylphenyl)silane has a molecular weight of 362.57 g/mol, XLogP of 1.96, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl(trimethoxy)silane;trimethoxy-(2-methylphenyl)silane is sourced from PubChem (CID 174740549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).