About 6-chlorochromen-4-one;ethane
6-chlorochromen-4-one;ethane (PubChem CID 174636561) has the molecular formula C11H11ClO2
and a molecular weight of 210.66 g/mol. Its IUPAC name is 6-chlorochromen-4-one;ethane.
Molecular Properties
| Compound Name | 6-chlorochromen-4-one;ethane |
| PubChem CID | 174636561 |
| Molecular Formula | C11H11ClO2 |
| Molecular Weight | 210.66 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | 6-chlorochromen-4-one;ethane |
| SMILES | CC.O=c1ccoc2ccc(Cl)cc12 |
| InChI | InChI=1S/C9H5ClO2.C2H6/c10-6-1-2-9-7(5-6)8(11)3-4-12-9;1-2/h1-5H;1-2H3 |
| InChIKey | PBXUIBFLCKPIBH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.66 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-chlorochromen-4-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chlorochromen-4-one;ethane?
The IUPAC name of 6-chlorochromen-4-one;ethane (CID 174636561) is 6-chlorochromen-4-one;ethane.
What is the SMILES notation for 6-chlorochromen-4-one;ethane?
The canonical SMILES for 6-chlorochromen-4-one;ethane is CC.O=c1ccoc2ccc(Cl)cc12.
What is the InChIKey of 6-chlorochromen-4-one;ethane?
The InChIKey is PBXUIBFLCKPIBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5ClO2.C2H6/c10-6-1-2-9-7(5-6)8(11)3-4-12-9;1-2/h1-5H;1-2H3.
What are the key properties of 6-chlorochromen-4-one;ethane?
6-chlorochromen-4-one;ethane has a molecular weight of 210.66 g/mol, XLogP of 3.47, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chlorochromen-4-one;ethane is sourced from PubChem (CID 174636561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).