C12H29ClN2O6 — CID 174637476
(3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol;3-hydroxypropyl(trimethyl)azanium;chloride (PubChem CID 174637476) has the molecular formula C12H29ClN2O6 and a molecular weight of 332.83 g/mol. Its IUPAC name is (3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol;3-hydroxypropyl(trimethyl)azanium;chloride.
| Compound Name | (3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol;3-hydroxypropyl(trimethyl)azanium;chloride |
|---|---|
| PubChem CID | 174637476 |
| Molecular Formula | C12H29ClN2O6 |
| Molecular Weight | 332.83 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | (3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol;3-hydroxypropyl(trimethyl)azanium;chloride |
| SMILES | C[N+](C)(C)CCCO.N[C@H]1C(O)O[C@H](CO)[C@@H](O)[C@@H]1O.[Cl-] |
| InChI | InChI=1S/C6H13NO5.C6H16NO.ClH/c7-3-5(10)4(9)2(1-8)12-6(3)11;1-7(2,3)5-4-6-8;/h2-6,8-11H,1,7H2;8H,4-6H2,1-3H3;1H/q;+1;/p-1/t2-,3-,4-,5-,6?;;/m1../s1 |
| InChIKey | SRCQGAYBHKVCIO-QOJDFBNTSA-M |
| XLogP | -6.18 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.83 |
| LogP ≤ 5 | -6.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|