C12H6Cl2F3N3O2 — CID 174638500
3-chloro-N-[5-chloro-2-hydroxy-4-(trifluoromethyl)phenyl]pyrazine-2-carboxamide (PubChem CID 174638500) has the molecular formula C12H6Cl2F3N3O2 and a molecular weight of 352.10 g/mol. Its IUPAC name is 3-chloro-N-[5-chloro-2-hydroxy-4-(trifluoromethyl)phenyl]pyrazine-2-carboxamide.
| Compound Name | 3-chloro-N-[5-chloro-2-hydroxy-4-(trifluoromethyl)phenyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 174638500 |
| Molecular Formula | C12H6Cl2F3N3O2 |
| Molecular Weight | 352.10 g/mol |
| Exact Mass | 350.98 |
| IUPAC Name | 3-chloro-N-[5-chloro-2-hydroxy-4-(trifluoromethyl)phenyl]pyrazine-2-carboxamide |
| SMILES | O=C(Nc1cc(Cl)c(C(F)(F)F)cc1O)c1nccnc1Cl |
| InChI | InChI=1S/C12H6Cl2F3N3O2/c13-6-4-7(8(21)3-5(6)12(15,16)17)20-11(22)9-10(14)19-2-1-18-9/h1-4,21H,(H,20,22) |
| InChIKey | QSCIUNDTGWBCNP-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.10 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|