C12H7F4N3O2 — CID 174638461
3-fluoro-N-[2-hydroxy-5-(trifluoromethyl)phenyl]pyrazine-2-carboxamide (PubChem CID 174638461) has the molecular formula C12H7F4N3O2 and a molecular weight of 301.20 g/mol. Its IUPAC name is 3-fluoro-N-[2-hydroxy-5-(trifluoromethyl)phenyl]pyrazine-2-carboxamide.
| Compound Name | 3-fluoro-N-[2-hydroxy-5-(trifluoromethyl)phenyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 174638461 |
| Molecular Formula | C12H7F4N3O2 |
| Molecular Weight | 301.20 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 3-fluoro-N-[2-hydroxy-5-(trifluoromethyl)phenyl]pyrazine-2-carboxamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)ccc1O)c1nccnc1F |
| InChI | InChI=1S/C12H7F4N3O2/c13-10-9(17-3-4-18-10)11(21)19-7-5-6(12(14,15)16)1-2-8(7)20/h1-5,20H,(H,19,21) |
| InChIKey | LNCGCNULMPUTCJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.20 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|