C8H16N2O4 — CID 174640793
(4-ethyl-2,3-dihydroxypiperazin-1-yl) acetate (PubChem CID 174640793) has the molecular formula C8H16N2O4 and a molecular weight of 204.23 g/mol. Its IUPAC name is (4-ethyl-2,3-dihydroxypiperazin-1-yl) acetate.
| Compound Name | (4-ethyl-2,3-dihydroxypiperazin-1-yl) acetate |
|---|---|
| PubChem CID | 174640793 |
| Molecular Formula | C8H16N2O4 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | (4-ethyl-2,3-dihydroxypiperazin-1-yl) acetate |
| SMILES | CCN1CCN(OC(C)=O)C(O)C1O |
| InChI | InChI=1S/C8H16N2O4/c1-3-9-4-5-10(14-6(2)11)8(13)7(9)12/h7-8,12-13H,3-5H2,1-2H3 |
| InChIKey | HUBQPLXAHRTLGR-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 73.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |