C15H12N2O2S — CID 174641658
2-pyridin-3-ylnaphthalene-1-sulfonamide (PubChem CID 174641658) has the molecular formula C15H12N2O2S and a molecular weight of 284.34 g/mol. Its IUPAC name is 2-pyridin-3-ylnaphthalene-1-sulfonamide.
| Compound Name | 2-pyridin-3-ylnaphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 174641658 |
| Molecular Formula | C15H12N2O2S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 2-pyridin-3-ylnaphthalene-1-sulfonamide |
| SMILES | NS(=O)(=O)c1c(-c2cccnc2)ccc2ccccc12 |
| InChI | InChI=1S/C15H12N2O2S/c16-20(18,19)15-13-6-2-1-4-11(13)7-8-14(15)12-5-3-9-17-10-12/h1-10H,(H2,16,18,19) |
| InChIKey | YULYUANSNYRMDA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |