C26H20FN3O4S — CID 67718981
3-cyano-2-[(4-fluorophenyl)-(4-methoxyphenyl)methoxy]-6-pyridin-3-ylbenzenesulfonamide (PubChem CID 67718981) has the molecular formula C26H20FN3O4S and a molecular weight of 489.53 g/mol. Its IUPAC name is 3-cyano-2-[(4-fluorophenyl)-(4-methoxyphenyl)methoxy]-6-pyridin-3-ylbenzenesulfonamide.
| Compound Name | 3-cyano-2-[(4-fluorophenyl)-(4-methoxyphenyl)methoxy]-6-pyridin-3-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 67718981 |
| Molecular Formula | C26H20FN3O4S |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | 3-cyano-2-[(4-fluorophenyl)-(4-methoxyphenyl)methoxy]-6-pyridin-3-ylbenzenesulfonamide |
| SMILES | COc1ccc(C(Oc2c(C#N)ccc(-c3cccnc3)c2S(N)(=O)=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C26H20FN3O4S/c1-33-22-11-6-18(7-12-22)24(17-4-9-21(27)10-5-17)34-25-19(15-28)8-13-23(26(25)35(29,31)32)20-3-2-14-30-16-20/h2-14,16,24H,1H3,(H2,29,31,32) |
| InChIKey | ISQNUWCOCFRIIV-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 115.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |