C36H40ClN3O4 — CID 174643206
methyl 2-[4-[4-[[2-(4-chlorophenyl)-5-[3-(dimethylamino)propoxy]phenyl]methyl]piperazin-1-yl]phenoxy]benzoate (PubChem CID 174643206) has the molecular formula C36H40ClN3O4 and a molecular weight of 614.19 g/mol. Its IUPAC name is methyl 2-[4-[4-[[2-(4-chlorophenyl)-5-[3-(dimethylamino)propoxy]phenyl]methyl]piperazin-1-yl]phenoxy]benzoate.
| Compound Name | methyl 2-[4-[4-[[2-(4-chlorophenyl)-5-[3-(dimethylamino)propoxy]phenyl]methyl]piperazin-1-yl]phenoxy]benzoate |
|---|---|
| PubChem CID | 174643206 |
| Molecular Formula | C36H40ClN3O4 |
| Molecular Weight | 614.19 g/mol |
| Exact Mass | 613.27 |
| IUPAC Name | methyl 2-[4-[4-[[2-(4-chlorophenyl)-5-[3-(dimethylamino)propoxy]phenyl]methyl]piperazin-1-yl]phenoxy]benzoate |
| SMILES | COC(=O)c1ccccc1Oc1ccc(N2CCN(Cc3cc(OCCCN(C)C)ccc3-c3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C36H40ClN3O4/c1-38(2)19-6-24-43-32-17-18-33(27-9-11-29(37)12-10-27)28(25-32)26-39-20-22-40(23-21-39)30-13-15-31(16-14-30)44-35-8-5-4-7-34(35)36(41)42-3/h4-5,7-18,25H,6,19-24,26H2,1-3H3 |
| InChIKey | NKCVVIZSBFDVNG-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 54.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.19 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|