C32H32ClN3O2 — CID 67144773
methyl 2-(benzylamino)-4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]benzoate (PubChem CID 67144773) has the molecular formula C32H32ClN3O2 and a molecular weight of 526.08 g/mol. Its IUPAC name is methyl 2-(benzylamino)-4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]benzoate.
| Compound Name | methyl 2-(benzylamino)-4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]benzoate |
|---|---|
| PubChem CID | 67144773 |
| Molecular Formula | C32H32ClN3O2 |
| Molecular Weight | 526.08 g/mol |
| Exact Mass | 525.22 |
| IUPAC Name | methyl 2-(benzylamino)-4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2CCN(Cc3ccccc3-c3ccc(Cl)cc3)CC2)cc1NCc1ccccc1 |
| InChI | InChI=1S/C32H32ClN3O2/c1-38-32(37)30-16-15-28(21-31(30)34-22-24-7-3-2-4-8-24)36-19-17-35(18-20-36)23-26-9-5-6-10-29(26)25-11-13-27(33)14-12-25/h2-16,21,34H,17-20,22-23H2,1H3 |
| InChIKey | CNURWRVWQNRBDT-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.08 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |