About acetonitrile;pyrimidine-5-carboxylic acid
acetonitrile;pyrimidine-5-carboxylic acid (PubChem CID 174645465) has the molecular formula C7H7N3O2
and a molecular weight of 165.15 g/mol. Its IUPAC name is acetonitrile;pyrimidine-5-carboxylic acid.
Molecular Properties
| Compound Name | acetonitrile;pyrimidine-5-carboxylic acid |
| PubChem CID | 174645465 |
| Molecular Formula | C7H7N3O2 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.05 |
| IUPAC Name | acetonitrile;pyrimidine-5-carboxylic acid |
| SMILES | CC#N.O=C(O)c1cncnc1 |
| InChI | InChI=1S/C5H4N2O2.C2H3N/c8-5(9)4-1-6-3-7-2-4;1-2-3/h1-3H,(H,8,9);1H3 |
| InChIKey | CXGZVQJMABMPQY-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze acetonitrile;pyrimidine-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;pyrimidine-5-carboxylic acid?
The IUPAC name of acetonitrile;pyrimidine-5-carboxylic acid (CID 174645465) is acetonitrile;pyrimidine-5-carboxylic acid.
What is the SMILES notation for acetonitrile;pyrimidine-5-carboxylic acid?
The canonical SMILES for acetonitrile;pyrimidine-5-carboxylic acid is CC#N.O=C(O)c1cncnc1.
What is the InChIKey of acetonitrile;pyrimidine-5-carboxylic acid?
The InChIKey is CXGZVQJMABMPQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2O2.C2H3N/c8-5(9)4-1-6-3-7-2-4;1-2-3/h1-3H,(H,8,9);1H3.
What are the key properties of acetonitrile;pyrimidine-5-carboxylic acid?
acetonitrile;pyrimidine-5-carboxylic acid has a molecular weight of 165.15 g/mol, XLogP of 0.70, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;pyrimidine-5-carboxylic acid is sourced from PubChem (CID 174645465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).